C31H28ClFN6O3S — CID 118025498
4-amino-N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]cyclohexyl]-3-fluorobenzamide (PubChem CID 118025498) has the molecular formula C31H28ClFN6O3S and a molecular weight of 619.12 g/mol. Its IUPAC name is 4-amino-N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]cyclohexyl]-3-fluorobenzamide.
| Compound Name | 4-amino-N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]cyclohexyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 118025498 |
| Molecular Formula | C31H28ClFN6O3S |
| Molecular Weight | 619.12 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | 4-amino-N-[(1S,3R)-3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]cyclohexyl]-3-fluorobenzamide |
| SMILES | Nc1ccc(C(=O)N[C@H]2CCC[C@@H](Nc3ncc(Cl)c(-c4cn(S(=O)(=O)c5ccccc5)c5ccccc45)n3)C2)cc1F |
| InChI | InChI=1S/C31H28ClFN6O3S/c32-25-17-35-31(37-21-8-6-7-20(16-21)36-30(40)19-13-14-27(34)26(33)15-19)38-29(25)24-18-39(28-12-5-4-11-23(24)28)43(41,42)22-9-2-1-3-10-22/h1-5,9-15,17-18,20-21H,6-8,16,34H2,(H,36,40)(H,35,37,38)/t20-,21+/m0/s1 |
| InChIKey | HMNPTQGRLKHZMO-LEWJYISDSA-N |
| XLogP | 5.86 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.12 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|