C22H17ClN6O2 — CID 118025546
1-[3-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroindol-1-yl]prop-2-en-1-one (PubChem CID 118025546) has the molecular formula C22H17ClN6O2 and a molecular weight of 432.87 g/mol. Its IUPAC name is 1-[3-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroindol-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroindol-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118025546 |
| Molecular Formula | C22H17ClN6O2 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1-[3-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2,3-dihydroindol-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(n2nc(-c3ccc(Cl)c(O)c3)c3c(N)ncnc32)c2ccccc21 |
| InChI | InChI=1S/C22H17ClN6O2/c1-2-18(31)28-10-16(13-5-3-4-6-15(13)28)29-22-19(21(24)25-11-26-22)20(27-29)12-7-8-14(23)17(30)9-12/h2-9,11,16,30H,1,10H2,(H2,24,25,26) |
| InChIKey | JSMVPYINTRIYHO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|