C24H20FN5O2 — CID 118025732
[3-[4-amino-1-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenyl] prop-2-enoate (PubChem CID 118025732) has the molecular formula C24H20FN5O2 and a molecular weight of 429.46 g/mol. Its IUPAC name is [3-[4-amino-1-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenyl] prop-2-enoate.
| Compound Name | [3-[4-amino-1-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenyl] prop-2-enoate |
|---|---|
| PubChem CID | 118025732 |
| Molecular Formula | C24H20FN5O2 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [3-[4-amino-1-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(F)cc(-c2nn(C3CCc4ccccc4C3)c3ncnc(N)c23)c1 |
| InChI | InChI=1S/C24H20FN5O2/c1-2-20(31)32-19-11-16(9-17(25)12-19)22-21-23(26)27-13-28-24(21)30(29-22)18-8-7-14-5-3-4-6-15(14)10-18/h2-6,9,11-13,18H,1,7-8,10H2,(H2,26,27,28) |
| InChIKey | WSNODQFBVTTYCT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|