C20H17FN6 — CID 118025757
3-(3-amino-4-fluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 118025757) has the molecular formula C20H17FN6 and a molecular weight of 360.40 g/mol. Its IUPAC name is 3-(3-amino-4-fluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(3-amino-4-fluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118025757 |
| Molecular Formula | C20H17FN6 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-(3-amino-4-fluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1cc(-c2nn(C3Cc4ccccc4C3)c3ncnc(N)c23)ccc1F |
| InChI | InChI=1S/C20H17FN6/c21-15-6-5-13(9-16(15)22)18-17-19(23)24-10-25-20(17)27(26-18)14-7-11-3-1-2-4-12(11)8-14/h1-6,9-10,14H,7-8,22H2,(H2,23,24,25) |
| InChIKey | NAOHYIQSGMQVSJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|