C18H27N3O11S3 — CID 11802605
(2S)-2-[[(2S)-2-[[(2S,3R)-3-amino-2-sulfanyl-5-sulfopentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-sulfobutanoic acid (PubChem CID 11802605) has the molecular formula C18H27N3O11S3 and a molecular weight of 557.63 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S,3R)-3-amino-2-sulfanyl-5-sulfopentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-sulfobutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S,3R)-3-amino-2-sulfanyl-5-sulfopentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-sulfobutanoic acid |
|---|---|
| PubChem CID | 11802605 |
| Molecular Formula | C18H27N3O11S3 |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S,3R)-3-amino-2-sulfanyl-5-sulfopentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-sulfobutanoic acid |
| SMILES | N[C@H](CCS(=O)(=O)O)[C@H](S)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C18H27N3O11S3/c19-12(5-7-34(27,28)29)15(33)17(24)21-14(9-10-1-3-11(22)4-2-10)16(23)20-13(18(25)26)6-8-35(30,31)32/h1-4,12-15,22,33H,5-9,19H2,(H,20,23)(H,21,24)(H,25,26)(H,27,28,29)(H,30,31,32)/t12-,13+,14+,15+/m1/s1 |
| InChIKey | VWCXFZYAOLHQOH-QPSCCSFWSA-N |
| XLogP | -1.83 |
| TPSA | 250.49 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|