C20H16F2N6 — CID 118026133
3-(3-amino-4,5-difluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 118026133) has the molecular formula C20H16F2N6 and a molecular weight of 378.39 g/mol. Its IUPAC name is 3-(3-amino-4,5-difluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(3-amino-4,5-difluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118026133 |
| Molecular Formula | C20H16F2N6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-(3-amino-4,5-difluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1cc(-c2nn(C3Cc4ccccc4C3)c3ncnc(N)c23)cc(F)c1F |
| InChI | InChI=1S/C20H16F2N6/c21-14-7-12(8-15(23)17(14)22)18-16-19(24)25-9-26-20(16)28(27-18)13-5-10-3-1-2-4-11(10)6-13/h1-4,7-9,13H,5-6,23H2,(H2,24,25,26) |
| InChIKey | KHCGPXSXZFIPFA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|