About S-cyano 4-methylpentanethioate
S-cyano 4-methylpentanethioate (PubChem CID 118026402) has the molecular formula C7H11NOS
and a molecular weight of 157.24 g/mol. Its IUPAC name is S-cyano 4-methylpentanethioate.
Molecular Properties
| Compound Name | S-cyano 4-methylpentanethioate |
| PubChem CID | 118026402 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | S-cyano 4-methylpentanethioate |
| SMILES | CC(C)CCC(=O)SC#N |
| InChI | InChI=1S/C7H11NOS/c1-6(2)3-4-7(9)10-5-8/h6H,3-4H2,1-2H3 |
| InChIKey | ACIFRCIEQTUUPH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-cyano 4-methylpentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-cyano 4-methylpentanethioate?
The IUPAC name of S-cyano 4-methylpentanethioate (CID 118026402) is S-cyano 4-methylpentanethioate.
What is the SMILES notation for S-cyano 4-methylpentanethioate?
The canonical SMILES for S-cyano 4-methylpentanethioate is CC(C)CCC(=O)SC#N.
What is the InChIKey of S-cyano 4-methylpentanethioate?
The InChIKey is ACIFRCIEQTUUPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NOS/c1-6(2)3-4-7(9)10-5-8/h6H,3-4H2,1-2H3.
What are the key properties of S-cyano 4-methylpentanethioate?
S-cyano 4-methylpentanethioate has a molecular weight of 157.24 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-cyano 4-methylpentanethioate is sourced from PubChem (CID 118026402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).