C26H31N3O7 — CID 118026638
(3S,4S,6S)-6-[[(1S,2S,5R)-4-azido-3-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-5-methyl-4-phenylmethoxyoxan-3-ol (PubChem CID 118026638) has the molecular formula C26H31N3O7 and a molecular weight of 497.55 g/mol. Its IUPAC name is (3S,4S,6S)-6-[[(1S,2S,5R)-4-azido-3-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-5-methyl-4-phenylmethoxyoxan-3-ol.
| Compound Name | (3S,4S,6S)-6-[[(1S,2S,5R)-4-azido-3-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-5-methyl-4-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 118026638 |
| Molecular Formula | C26H31N3O7 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | (3S,4S,6S)-6-[[(1S,2S,5R)-4-azido-3-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-5-methyl-4-phenylmethoxyoxan-3-ol |
| SMILES | CC1[C@H](O[C@H]2C(OCc3ccccc3)C(N=[N+]=[N-])[C@@H]3OC[C@@H]2O3)OC[C@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H31N3O7/c1-16-22(31-12-17-8-4-2-5-9-17)19(30)14-33-25(16)36-23-20-15-34-26(35-20)21(28-29-27)24(23)32-13-18-10-6-3-7-11-18/h2-11,16,19-26,30H,12-15H2,1H3/t16?,19-,20-,21?,22-,23+,24?,25-,26+/m0/s1 |
| InChIKey | GDDCPXZAUGIHEO-AVTHHOQBSA-N |
| XLogP | 3.33 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|