About 1,5-dimethyl-1,2,4-triazolidine
1,5-dimethyl-1,2,4-triazolidine (PubChem CID 118026873) has the molecular formula C4H11N3
and a molecular weight of 101.15 g/mol. Its IUPAC name is 1,5-dimethyl-1,2,4-triazolidine.
Molecular Properties
| Compound Name | 1,5-dimethyl-1,2,4-triazolidine |
| PubChem CID | 118026873 |
| Molecular Formula | C4H11N3 |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | 1,5-dimethyl-1,2,4-triazolidine |
| SMILES | CC1NCNN1C |
| InChI | InChI=1S/C4H11N3/c1-4-5-3-6-7(4)2/h4-6H,3H2,1-2H3 |
| InChIKey | SLBUVSILUWAYRY-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-dimethyl-1,2,4-triazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-1,2,4-triazolidine?
The IUPAC name of 1,5-dimethyl-1,2,4-triazolidine (CID 118026873) is 1,5-dimethyl-1,2,4-triazolidine.
What is the SMILES notation for 1,5-dimethyl-1,2,4-triazolidine?
The canonical SMILES for 1,5-dimethyl-1,2,4-triazolidine is CC1NCNN1C.
What is the InChIKey of 1,5-dimethyl-1,2,4-triazolidine?
The InChIKey is SLBUVSILUWAYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3/c1-4-5-3-6-7(4)2/h4-6H,3H2,1-2H3.
What are the key properties of 1,5-dimethyl-1,2,4-triazolidine?
1,5-dimethyl-1,2,4-triazolidine has a molecular weight of 101.15 g/mol, XLogP of -0.67, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-1,2,4-triazolidine is sourced from PubChem (CID 118026873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).