C18H22ClF3N4O3S — CID 118027008
N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methyl-3-(4,4,4-trifluorobutylsulfinyl)propanamide (PubChem CID 118027008) has the molecular formula C18H22ClF3N4O3S and a molecular weight of 466.91 g/mol. Its IUPAC name is N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methyl-3-(4,4,4-trifluorobutylsulfinyl)propanamide.
| Compound Name | N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methyl-3-(4,4,4-trifluorobutylsulfinyl)propanamide |
|---|---|
| PubChem CID | 118027008 |
| Molecular Formula | C18H22ClF3N4O3S |
| Molecular Weight | 466.91 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methyl-3-(4,4,4-trifluorobutylsulfinyl)propanamide |
| SMILES | CCN(C(=O)C(C)CS(=O)CCCC(F)(F)F)c1cn(-c2ccc[n+]([O-])c2)nc1Cl |
| InChI | InChI=1S/C18H22ClF3N4O3S/c1-3-25(17(27)13(2)12-30(29)9-5-7-18(20,21)22)15-11-26(23-16(15)19)14-6-4-8-24(28)10-14/h4,6,8,10-11,13H,3,5,7,9,12H2,1-2H3 |
| InChIKey | OLTQYBSZRBERRW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.91 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|