C8H9FN2O2S — CID 118027097
5-(fluoromethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid (PubChem CID 118027097) has the molecular formula C8H9FN2O2S and a molecular weight of 216.24 g/mol. Its IUPAC name is 5-(fluoromethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid.
| Compound Name | 5-(fluoromethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 118027097 |
| Molecular Formula | C8H9FN2O2S |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 5-(fluoromethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc2c(s1)CN(CF)CC2 |
| InChI | InChI=1S/C8H9FN2O2S/c9-4-11-2-1-5-6(3-11)14-7(10-5)8(12)13/h1-4H2,(H,12,13) |
| InChIKey | KJZUXIKKIXSBND-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|