C33H31NO4 — CID 118027241
ethyl (2S)-2-[(2-methylpropan-2-yl)oxy]-2-[10-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)phenanthren-9-yl]acetate (PubChem CID 118027241) has the molecular formula C33H31NO4 and a molecular weight of 505.61 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-methylpropan-2-yl)oxy]-2-[10-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)phenanthren-9-yl]acetate.
| Compound Name | ethyl (2S)-2-[(2-methylpropan-2-yl)oxy]-2-[10-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)phenanthren-9-yl]acetate |
|---|---|
| PubChem CID | 118027241 |
| Molecular Formula | C33H31NO4 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | ethyl (2S)-2-[(2-methylpropan-2-yl)oxy]-2-[10-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)phenanthren-9-yl]acetate |
| SMILES | CCOC(=O)[C@@H](OC(C)(C)C)c1c(-c2ccc3c4c(ccnc24)CCO3)c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C33H31NO4/c1-5-36-32(35)31(38-33(2,3)4)29-24-13-9-7-11-22(24)21-10-6-8-12-23(21)28(29)25-14-15-26-27-20(17-19-37-26)16-18-34-30(25)27/h6-16,18,31H,5,17,19H2,1-4H3/t31-/m0/s1 |
| InChIKey | USSCNOCPUUZAAU-HKBQPEDESA-N |
| XLogP | 7.56 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|