C16H15F3NO+ — CID 118027484
2-(4-ethylpyridin-1-ium-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 118027484) has the molecular formula C16H15F3NO+ and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-(4-ethylpyridin-1-ium-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-(4-ethylpyridin-1-ium-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 118027484 |
| Molecular Formula | C16H15F3NO+ |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-(4-ethylpyridin-1-ium-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | CCc1cc[n+](CC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H15F3NO/c1-2-12-7-9-20(10-8-12)11-15(21)13-3-5-14(6-4-13)16(17,18)19/h3-10H,2,11H2,1H3/q+1 |
| InChIKey | JPOWEKJLKDXUGM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|