C24H20FN — CID 118027716
2-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-4,6-diphenylaniline (PubChem CID 118027716) has the molecular formula C24H20FN and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-4,6-diphenylaniline.
| Compound Name | 2-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-4,6-diphenylaniline |
|---|---|
| PubChem CID | 118027716 |
| Molecular Formula | C24H20FN |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-fluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-4,6-diphenylaniline |
| SMILES | C=C/C=C(\C=C)Nc1c(F)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H20FN/c1-3-11-21(4-2)26-24-22(19-14-9-6-10-15-19)16-20(17-23(24)25)18-12-7-5-8-13-18/h3-17,26H,1-2H2/b21-11+ |
| InChIKey | YJIJUKHHSKXWBO-SRZZPIQSSA-N |
| XLogP | 6.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|