C21H20ClNO4S — CID 118027910
6-chloro-4-[2-(cyclopropylmethoxy)-5-methylsulfonylphenyl]-2-methylisoquinolin-1-one (PubChem CID 118027910) has the molecular formula C21H20ClNO4S and a molecular weight of 417.91 g/mol. Its IUPAC name is 6-chloro-4-[2-(cyclopropylmethoxy)-5-methylsulfonylphenyl]-2-methylisoquinolin-1-one.
| Compound Name | 6-chloro-4-[2-(cyclopropylmethoxy)-5-methylsulfonylphenyl]-2-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 118027910 |
| Molecular Formula | C21H20ClNO4S |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 6-chloro-4-[2-(cyclopropylmethoxy)-5-methylsulfonylphenyl]-2-methylisoquinolin-1-one |
| SMILES | Cn1cc(-c2cc(S(C)(=O)=O)ccc2OCC2CC2)c2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H20ClNO4S/c1-23-11-19(17-9-14(22)5-7-16(17)21(23)24)18-10-15(28(2,25)26)6-8-20(18)27-12-13-3-4-13/h5-11,13H,3-4,12H2,1-2H3 |
| InChIKey | KRXFNAPNSZKUKH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |