C29H23F3O4S — CID 118028304
[4-[1-[4-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)phenyl]-1-(4-hydroxyphenyl)ethyl]phenyl] trifluoromethanesulfonate (PubChem CID 118028304) has the molecular formula C29H23F3O4S and a molecular weight of 524.56 g/mol. Its IUPAC name is [4-[1-[4-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)phenyl]-1-(4-hydroxyphenyl)ethyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[1-[4-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)phenyl]-1-(4-hydroxyphenyl)ethyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118028304 |
| Molecular Formula | C29H23F3O4S |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | [4-[1-[4-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)phenyl]-1-(4-hydroxyphenyl)ethyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(c1ccc(O)cc1)(c1ccc(OS(=O)(=O)C(F)(F)F)cc1)c1ccc(-c2ccc3c(c2)CC3)cc1 |
| InChI | InChI=1S/C29H23F3O4S/c1-28(24-10-14-26(33)15-11-24,25-12-16-27(17-13-25)36-37(34,35)29(30,31)32)23-8-6-20(7-9-23)22-5-3-19-2-4-21(19)18-22/h3,5-18,33H,2,4H2,1H3 |
| InChIKey | IFUHCEIVEZQHNZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|