C15H24O6 — CID 118028646
(3aR,5S,6R,6aR)-5-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde (PubChem CID 118028646) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-5-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde.
| Compound Name | (3aR,5S,6R,6aR)-5-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 118028646 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3aR,5S,6R,6aR)-5-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
| SMILES | C=CC[C@H](OCOC)[C@@]1(C=O)O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C15H24O6/c1-6-7-11(18-9-17-5)15(8-16)10(2)12-13(21-15)20-14(3,4)19-12/h6,8,10-13H,1,7,9H2,2-5H3/t10-,11+,12-,13+,15+/m1/s1 |
| InChIKey | KGCQNPMHCRFQME-JYKNGBAOSA-N |
| XLogP | 1.63 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|