C18H28O6 — CID 118028667
[(1S)-1-[(3aR,5S,6R,6aR)-5-formyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]but-3-enyl] 2,2-dimethylpropanoate (PubChem CID 118028667) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(1S)-1-[(3aR,5S,6R,6aR)-5-formyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]but-3-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(1S)-1-[(3aR,5S,6R,6aR)-5-formyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]but-3-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118028667 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(1S)-1-[(3aR,5S,6R,6aR)-5-formyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]but-3-enyl] 2,2-dimethylpropanoate |
| SMILES | C=CC[C@H](OC(=O)C(C)(C)C)[C@@]1(C=O)O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C18H28O6/c1-8-9-12(21-15(20)16(3,4)5)18(10-19)11(2)13-14(24-18)23-17(6,7)22-13/h8,10-14H,1,9H2,2-7H3/t11-,12+,13-,14+,18+/m1/s1 |
| InChIKey | MVFKOJQWNZUSQK-MTVAPTMQSA-N |
| XLogP | 2.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|