C13H21F6N3O8S3 — CID 118029355
methyl 2-[4-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonyl-2,6-dimethylpiperazin-1-yl]acetate (PubChem CID 118029355) has the molecular formula C13H21F6N3O8S3 and a molecular weight of 557.51 g/mol. Its IUPAC name is methyl 2-[4-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonyl-2,6-dimethylpiperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonyl-2,6-dimethylpiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 118029355 |
| Molecular Formula | C13H21F6N3O8S3 |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | methyl 2-[4-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonyl-2,6-dimethylpiperazin-1-yl]acetate |
| SMILES | COC(=O)CN1C(C)CN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(C)(=O)=O)CC1C |
| InChI | InChI=1S/C13H21F6N3O8S3/c1-8-5-21(6-9(2)22(8)7-10(23)30-3)33(28,29)13(18,19)11(14,15)12(16,17)32(26,27)20-31(4,24)25/h8-9,20H,5-7H2,1-4H3 |
| InChIKey | AVFGBBYOALEIRD-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|