C9H17F4NO — CID 118029375
N,N-diethyl-2-(1,1,2,2-tetrafluoropropoxy)ethanamine (PubChem CID 118029375) has the molecular formula C9H17F4NO and a molecular weight of 231.23 g/mol. Its IUPAC name is N,N-diethyl-2-(1,1,2,2-tetrafluoropropoxy)ethanamine.
| Compound Name | N,N-diethyl-2-(1,1,2,2-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 118029375 |
| Molecular Formula | C9H17F4NO |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | N,N-diethyl-2-(1,1,2,2-tetrafluoropropoxy)ethanamine |
| SMILES | CCN(CC)CCOC(F)(F)C(C)(F)F |
| InChI | InChI=1S/C9H17F4NO/c1-4-14(5-2)6-7-15-9(12,13)8(3,10)11/h4-7H2,1-3H3 |
| InChIKey | PEULJXOBRPVRNM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|