C18H19F3N4OS2 — CID 118029834
N-but-3-yn-2-yl-N-(4-methyl-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide (PubChem CID 118029834) has the molecular formula C18H19F3N4OS2 and a molecular weight of 428.51 g/mol. Its IUPAC name is N-but-3-yn-2-yl-N-(4-methyl-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide.
| Compound Name | N-but-3-yn-2-yl-N-(4-methyl-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide |
|---|---|
| PubChem CID | 118029834 |
| Molecular Formula | C18H19F3N4OS2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-but-3-yn-2-yl-N-(4-methyl-2-pyrimidin-5-yl-1,3-thiazol-5-yl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide |
| SMILES | C#CC(C)N(C(=O)CCSCCC(F)(F)F)c1sc(-c2cncnc2)nc1C |
| InChI | InChI=1S/C18H19F3N4OS2/c1-4-12(2)25(15(26)5-7-27-8-6-18(19,20)21)17-13(3)24-16(28-17)14-9-22-11-23-10-14/h1,9-12H,5-8H2,2-3H3 |
| InChIKey | UFBVXSKJTVTTHX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|