About 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole
3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole (PubChem CID 118030077) has the molecular formula C6H7ClF2N2
and a molecular weight of 180.59 g/mol. Its IUPAC name is 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole |
| PubChem CID | 118030077 |
| Molecular Formula | C6H7ClF2N2 |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole |
| SMILES | Cc1c(Cl)nn(C(F)F)c1C |
| InChI | InChI=1S/C6H7ClF2N2/c1-3-4(2)11(6(8)9)10-5(3)7/h6H,1-2H3 |
| InChIKey | HVEFGSRIENXVNZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole?
The IUPAC name of 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole (CID 118030077) is 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole.
What is the SMILES notation for 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole?
The canonical SMILES for 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole is Cc1c(Cl)nn(C(F)F)c1C.
What is the InChIKey of 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole?
The InChIKey is HVEFGSRIENXVNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClF2N2/c1-3-4(2)11(6(8)9)10-5(3)7/h6H,1-2H3.
What are the key properties of 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole?
3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole has a molecular weight of 180.59 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-(difluoromethyl)-4,5-dimethylpyrazole is sourced from PubChem (CID 118030077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).