C11H14BrN — CID 118030424
(6Z)-2-(1-bromo-2-methylpropan-2-yl)-1-azacycloocta-2,3,6,8-tetraene (PubChem CID 118030424) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is (6Z)-2-(1-bromo-2-methylpropan-2-yl)-1-azacycloocta-2,3,6,8-tetraene.
| Compound Name | (6Z)-2-(1-bromo-2-methylpropan-2-yl)-1-azacycloocta-2,3,6,8-tetraene |
|---|---|
| PubChem CID | 118030424 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (6Z)-2-(1-bromo-2-methylpropan-2-yl)-1-azacycloocta-2,3,6,8-tetraene |
| SMILES | CC(C)(CBr)C1=C=CC/C=C\C=N/1 |
| InChI | InChI=1S/C11H14BrN/c1-11(2,9-12)10-7-5-3-4-6-8-13-10/h4-6,8H,3,9H2,1-2H3/b6-4-,13-8- |
| InChIKey | MQGLGNSOBKCPIY-QBZDRKLNSA-N |
| XLogP | 3.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|