About (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile
(2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile (PubChem CID 118030462) has the molecular formula C9H9BrN2
and a molecular weight of 225.09 g/mol. Its IUPAC name is (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile.
Molecular Properties
| Compound Name | (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile |
| PubChem CID | 118030462 |
| Molecular Formula | C9H9BrN2 |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile |
| SMILES | C/C1=C(C#N)/N=C\C(Br)=C/CC1 |
| InChI | InChI=1S/C9H9BrN2/c1-7-3-2-4-8(10)6-12-9(7)5-11/h4,6H,2-3H2,1H3/b8-4+,9-7-,12-6- |
| InChIKey | RXAKSQHZHFIVRK-YUTTUKGNSA-N |
| XLogP | 2.93 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile?
The IUPAC name of (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile (CID 118030462) is (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile.
What is the SMILES notation for (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile?
The canonical SMILES for (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile is C/C1=C(C#N)/N=C\C(Br)=C/CC1.
What is the InChIKey of (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile?
The InChIKey is RXAKSQHZHFIVRK-YUTTUKGNSA-N. The full InChI is InChI=1S/C9H9BrN2/c1-7-3-2-4-8(10)6-12-9(7)5-11/h4,6H,2-3H2,1H3/b8-4+,9-7-,12-6-.
What are the key properties of (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile?
(2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile has a molecular weight of 225.09 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6E)-7-bromo-3-methyl-4,5-dihydroazocine-2-carbonitrile is sourced from PubChem (CID 118030462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).