C14H21BrN4O3S2 — CID 118030481
2-[[3-(5-bromo-2-pyridinyl)-5-methylsulfonyl-1,2,4-triazol-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane (PubChem CID 118030481) has the molecular formula C14H21BrN4O3S2 and a molecular weight of 437.39 g/mol. Its IUPAC name is 2-[[3-(5-bromo-2-pyridinyl)-5-methylsulfonyl-1,2,4-triazol-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane.
| Compound Name | 2-[[3-(5-bromo-2-pyridinyl)-5-methylsulfonyl-1,2,4-triazol-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 118030481 |
| Molecular Formula | C14H21BrN4O3S2 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 2-[[3-(5-bromo-2-pyridinyl)-5-methylsulfonyl-1,2,4-triazol-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane |
| SMILES | CS(C)(C)CCOCn1nc(-c2ccc(Br)cn2)nc1S(C)(=O)=O |
| InChI | InChI=1S/C14H21BrN4O3S2/c1-23(2,3)8-7-22-10-19-14(24(4,20)21)17-13(18-19)12-6-5-11(15)9-16-12/h5-6,9H,7-8,10H2,1-4H3 |
| InChIKey | FSCSZKTYUPAXGX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|