C21H34O7 — CID 118030679
[(1S)-1-[(3aR,5R,6R,6aR)-6-butoxy-5-formyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]but-3-enyl] 2,2-dimethylpropanoate (PubChem CID 118030679) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is [(1S)-1-[(3aR,5R,6R,6aR)-6-butoxy-5-formyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]but-3-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(1S)-1-[(3aR,5R,6R,6aR)-6-butoxy-5-formyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]but-3-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118030679 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | [(1S)-1-[(3aR,5R,6R,6aR)-6-butoxy-5-formyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]but-3-enyl] 2,2-dimethylpropanoate |
| SMILES | C=CC[C@H](OC(=O)C(C)(C)C)[C@@]1(C=O)O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCCCC |
| InChI | InChI=1S/C21H34O7/c1-8-10-12-24-16-15-17(27-20(6,7)26-15)28-21(16,13-22)14(11-9-2)25-18(23)19(3,4)5/h9,13-17H,2,8,10-12H2,1,3-7H3/t14-,15+,16+,17-,21+/m0/s1 |
| InChIKey | DAQIOOCPOGRIMX-PLCHWVDCSA-N |
| XLogP | 3.15 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|