C15H15F6NO — CID 118030707
(5S,6R)-3,6-dimethyl-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one (PubChem CID 118030707) has the molecular formula C15H15F6NO and a molecular weight of 339.28 g/mol. Its IUPAC name is (5S,6R)-3,6-dimethyl-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one.
| Compound Name | (5S,6R)-3,6-dimethyl-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 118030707 |
| Molecular Formula | C15H15F6NO |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (5S,6R)-3,6-dimethyl-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one |
| SMILES | CC1C[C@@H](c2c(F)ccc(F)c2F)[C@@H](C)N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C15H15F6NO/c1-7-5-9(12-10(16)3-4-11(17)13(12)18)8(2)22(14(7)23)6-15(19,20)21/h3-4,7-9H,5-6H2,1-2H3/t7?,8-,9-/m1/s1 |
| InChIKey | PYFZQPFYOSEGCB-CFCGPWAMSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|