C13H17F9N2O7S2 — CID 118030872
3-[3,5-dimethyl-4-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 118030872) has the molecular formula C13H17F9N2O7S2 and a molecular weight of 548.40 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[3,5-dimethyl-4-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 118030872 |
| Molecular Formula | C13H17F9N2O7S2 |
| Molecular Weight | 548.40 g/mol |
| Exact Mass | 548.03 |
| IUPAC Name | 3-[3,5-dimethyl-4-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | CC1CN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)CC(C)N1CC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C13H17F9N2O7S2/c1-7-3-23(4-8(2)24(7)5-9(25)31-6-10(14,15)16)32(26,27)12(19,20)11(17,18)13(21,22)33(28,29)30/h7-8H,3-6H2,1-2H3,(H,28,29,30) |
| InChIKey | YNWFJJKLIYZJDC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|