C8H12F5NO5S — CID 118030918
2-[2-[ethyl(2,2,2-trifluoroethyl)amino]acetyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 118030918) has the molecular formula C8H12F5NO5S and a molecular weight of 329.24 g/mol. Its IUPAC name is 2-[2-[ethyl(2,2,2-trifluoroethyl)amino]acetyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[2-[ethyl(2,2,2-trifluoroethyl)amino]acetyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 118030918 |
| Molecular Formula | C8H12F5NO5S |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-[2-[ethyl(2,2,2-trifluoroethyl)amino]acetyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CCN(CC(=O)OCC(F)(F)S(=O)(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C8H12F5NO5S/c1-2-14(4-7(9,10)11)3-6(15)19-5-8(12,13)20(16,17)18/h2-5H2,1H3,(H,16,17,18) |
| InChIKey | KRAXOIMGAUVPBR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|