C11H16O2 — CID 118031010
(1S,3aR,7aS)-1-hydroxy-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one (PubChem CID 118031010) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1S,3aR,7aS)-1-hydroxy-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one.
| Compound Name | (1S,3aR,7aS)-1-hydroxy-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one |
|---|---|
| PubChem CID | 118031010 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1S,3aR,7aS)-1-hydroxy-7a-methyl-4-methylidene-1,2,3,3a,6,7-hexahydroinden-5-one |
| SMILES | C=C1C(=O)CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C11H16O2/c1-7-8-3-4-10(13)11(8,2)6-5-9(7)12/h8,10,13H,1,3-6H2,2H3/t8-,10-,11-/m0/s1 |
| InChIKey | DDNKBSAPQQPVIP-LSJOCFKGSA-N |
| XLogP | 1.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|