C29H48I2N2S2 — CID 11803126
1-octyl-4-[3-(1-octylpyridin-1-ium-4-yl)sulfanylpropylsulfanyl]pyridin-1-ium diiodide (PubChem CID 11803126) has the molecular formula C29H48I2N2S2 and a molecular weight of 742.66 g/mol. Its IUPAC name is 1-octyl-4-[3-(1-octylpyridin-1-ium-4-yl)sulfanylpropylsulfanyl]pyridin-1-ium diiodide.
| Compound Name | 1-octyl-4-[3-(1-octylpyridin-1-ium-4-yl)sulfanylpropylsulfanyl]pyridin-1-ium diiodide |
|---|---|
| PubChem CID | 11803126 |
| Molecular Formula | C29H48I2N2S2 |
| Molecular Weight | 742.66 g/mol |
| Exact Mass | 742.13 |
| IUPAC Name | 1-octyl-4-[3-(1-octylpyridin-1-ium-4-yl)sulfanylpropylsulfanyl]pyridin-1-ium diiodide |
| SMILES | CCCCCCCC[n+]1ccc(SCCCSc2cc[n+](CCCCCCCC)cc2)cc1.[I-].[I-] |
| InChI | InChI=1S/C29H48N2S2.2HI/c1-3-5-7-9-11-13-20-30-22-16-28(17-23-30)32-26-15-27-33-29-18-24-31(25-19-29)21-14-12-10-8-6-4-2;;/h16-19,22-25H,3-15,20-21,26-27H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | AJVZXFHLUDUEPG-UHFFFAOYSA-L |
| XLogP | 2.27 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.66 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|