C26H28N10 — CID 118031476
N-[4-[4-[5-(pyridin-2-ylmethyl)pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]-1,2,3,4-tetrahydroisoquinolin-7-amine (PubChem CID 118031476) has the molecular formula C26H28N10 and a molecular weight of 480.58 g/mol. Its IUPAC name is N-[4-[4-[5-(pyridin-2-ylmethyl)pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]-1,2,3,4-tetrahydroisoquinolin-7-amine.
| Compound Name | N-[4-[4-[5-(pyridin-2-ylmethyl)pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]-1,2,3,4-tetrahydroisoquinolin-7-amine |
|---|---|
| PubChem CID | 118031476 |
| Molecular Formula | C26H28N10 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | N-[4-[4-[5-(pyridin-2-ylmethyl)pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]-1,2,3,4-tetrahydroisoquinolin-7-amine |
| SMILES | c1ccc(Cc2cnc(N3CCN(c4ncnc(Nc5ccc6c(c5)CNCC6)n4)CC3)nc2)nc1 |
| InChI | InChI=1S/C26H28N10/c1-2-7-28-22(3-1)13-19-15-29-25(30-16-19)35-9-11-36(12-10-35)26-32-18-31-24(34-26)33-23-5-4-20-6-8-27-17-21(20)14-23/h1-5,7,14-16,18,27H,6,8-13,17H2,(H,31,32,33,34) |
| InChIKey | KWMWGKVDHSGGEO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |