C56H52O2 — CID 11803237
3,15-bis(3,5-ditert-butylphenyl)octacyclo[18.5.2.15,9.02,16.04,14.017,26.023,27.013,28]octacosa-1(26),2,4(14),5,7,9(28),10,12,15,17,19,23(27),24-tridecaene-21,22-dione (PubChem CID 11803237) has the molecular formula C56H52O2 and a molecular weight of 757.03 g/mol. Its IUPAC name is 3,15-bis(3,5-ditert-butylphenyl)octacyclo[18.5.2.15,9.02,16.04,14.017,26.023,27.013,28]octacosa-1(26),2,4(14),5,7,9(28),10,12,15,17,19,23(27),24-tridecaene-21,22-dione.
| Compound Name | 3,15-bis(3,5-ditert-butylphenyl)octacyclo[18.5.2.15,9.02,16.04,14.017,26.023,27.013,28]octacosa-1(26),2,4(14),5,7,9(28),10,12,15,17,19,23(27),24-tridecaene-21,22-dione |
|---|---|
| PubChem CID | 11803237 |
| Molecular Formula | C56H52O2 |
| Molecular Weight | 757.03 g/mol |
| Exact Mass | 756.40 |
| IUPAC Name | 3,15-bis(3,5-ditert-butylphenyl)octacyclo[18.5.2.15,9.02,16.04,14.017,26.023,27.013,28]octacosa-1(26),2,4(14),5,7,9(28),10,12,15,17,19,23(27),24-tridecaene-21,22-dione |
| SMILES | CC(C)(C)c1cc(-c2c3c4cccc5cccc(c3c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3c6ccc7c(=O)c(=O)c8ccc(c23)c6c87)c54)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C56H52O2/c1-53(2,3)32-23-30(24-33(27-32)54(4,5)6)43-47-36-17-13-15-29-16-14-18-37(42(29)36)48(47)44(31-25-34(55(7,8)9)28-35(26-31)56(10,11)12)50-39-20-22-41-46-40(51(57)52(41)58)21-19-38(45(39)46)49(43)50/h13-28H,1-12H3 |
| InChIKey | APOFJLUKTXJJLW-UHFFFAOYSA-N |
| XLogP | 14.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.03 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|