C43H33F2N3O6S — CID 11803244
N-[[(2S,4R)-1-[2-(2,4-difluorobenzoyl)benzoyl]-4-[(2-phenylphenyl)methoxy]pyrrolidin-2-yl]methyl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide (PubChem CID 11803244) has the molecular formula C43H33F2N3O6S and a molecular weight of 757.82 g/mol. Its IUPAC name is N-[[(2S,4R)-1-[2-(2,4-difluorobenzoyl)benzoyl]-4-[(2-phenylphenyl)methoxy]pyrrolidin-2-yl]methyl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide.
| Compound Name | N-[[(2S,4R)-1-[2-(2,4-difluorobenzoyl)benzoyl]-4-[(2-phenylphenyl)methoxy]pyrrolidin-2-yl]methyl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 11803244 |
| Molecular Formula | C43H33F2N3O6S |
| Molecular Weight | 757.82 g/mol |
| Exact Mass | 757.21 |
| IUPAC Name | N-[[(2S,4R)-1-[2-(2,4-difluorobenzoyl)benzoyl]-4-[(2-phenylphenyl)methoxy]pyrrolidin-2-yl]methyl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(C(=O)NC[C@@H]3C[C@@H](OCc4ccccc4-c4ccccc4)CN3C(=O)c3ccccc3C(=O)c3ccc(F)cc3F)cc2)S1 |
| InChI | InChI=1S/C43H33F2N3O6S/c44-30-18-19-36(37(45)21-30)39(49)34-12-6-7-13-35(34)42(52)48-24-32(54-25-29-10-4-5-11-33(29)27-8-2-1-3-9-27)22-31(48)23-46-40(50)28-16-14-26(15-17-28)20-38-41(51)47-43(53)55-38/h1-21,31-32H,22-25H2,(H,46,50)(H,47,51,53)/b38-20-/t31-,32+/m0/s1 |
| InChIKey | UHELBOJXUPVRLQ-WDRWBBAQSA-N |
| XLogP | 7.42 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.82 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|