About [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate
[3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate (PubChem CID 118033555) has the molecular formula C18H25NO4
and a molecular weight of 319.40 g/mol. Its IUPAC name is [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate.
Molecular Properties
| Compound Name | [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate |
| PubChem CID | 118033555 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate |
| SMILES | COC(=O)C(C(C)OC(=O)c1ccccc1)C1CC[C@H](C)N1C |
| InChI | InChI=1S/C18H25NO4/c1-12-10-11-15(19(12)3)16(18(21)22-4)13(2)23-17(20)14-8-6-5-7-9-14/h5-9,12-13,15-16H,10-11H2,1-4H3/t12-,13?,15?,16?/m0/s1 |
| InChIKey | CNSSMGJHLIHGLC-FYZVFFDKSA-N |
| XLogP | 2.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate?
The IUPAC name of [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate (CID 118033555) is [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate.
What is the SMILES notation for [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate?
The canonical SMILES for [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate is COC(=O)C(C(C)OC(=O)c1ccccc1)C1CC[C@H](C)N1C.
What is the InChIKey of [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate?
The InChIKey is CNSSMGJHLIHGLC-FYZVFFDKSA-N. The full InChI is InChI=1S/C18H25NO4/c1-12-10-11-15(19(12)3)16(18(21)22-4)13(2)23-17(20)14-8-6-5-7-9-14/h5-9,12-13,15-16H,10-11H2,1-4H3/t12-,13?,15?,16?/m0/s1.
What are the key properties of [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate?
[3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate has a molecular weight of 319.40 g/mol, XLogP of 2.50, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(5S)-1,5-dimethylpyrrolidin-2-yl]-4-methoxy-4-oxobutan-2-yl] benzoate is sourced from PubChem (CID 118033555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).