C27H30S — CID 118033800
4-[3,5-dimethyl-4-(5-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]-3,4,5a,9a-tetrahydrodibenzothiophene (PubChem CID 118033800) has the molecular formula C27H30S and a molecular weight of 386.60 g/mol. Its IUPAC name is 4-[3,5-dimethyl-4-(5-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]-3,4,5a,9a-tetrahydrodibenzothiophene.
| Compound Name | 4-[3,5-dimethyl-4-(5-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]-3,4,5a,9a-tetrahydrodibenzothiophene |
|---|---|
| PubChem CID | 118033800 |
| Molecular Formula | C27H30S |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 4-[3,5-dimethyl-4-(5-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]-3,4,5a,9a-tetrahydrodibenzothiophene |
| SMILES | CC1=C(C2=CC=CC(C)C2)C(C)CC(C2CC=CC3=C2SC2C=CC=CC32)=C1 |
| InChI | InChI=1S/C27H30S/c1-17-8-6-9-20(14-17)26-18(2)15-21(16-19(26)3)22-11-7-12-24-23-10-4-5-13-25(23)28-27(22)24/h4-10,12-13,15,17,19,22-23,25H,11,14,16H2,1-3H3 |
| InChIKey | YLNKGEDMXUAECJ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |