C29H34ClN7O2 — CID 118034013
tert-butyl N-[(4-aminophenyl)methyl]-N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]carbamate (PubChem CID 118034013) has the molecular formula C29H34ClN7O2 and a molecular weight of 548.09 g/mol. Its IUPAC name is tert-butyl N-[(4-aminophenyl)methyl]-N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(4-aminophenyl)methyl]-N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 118034013 |
| Molecular Formula | C29H34ClN7O2 |
| Molecular Weight | 548.09 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | tert-butyl N-[(4-aminophenyl)methyl]-N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(N)cc1)[C@H]1CCC[C@@H](Nc2ncc(Cl)c(-c3n[nH]c4ccccc34)n2)C1 |
| InChI | InChI=1S/C29H34ClN7O2/c1-29(2,3)39-28(38)37(17-18-11-13-19(31)14-12-18)21-8-6-7-20(15-21)33-27-32-16-23(30)26(34-27)25-22-9-4-5-10-24(22)35-36-25/h4-5,9-14,16,20-21H,6-8,15,17,31H2,1-3H3,(H,35,36)(H,32,33,34)/t20-,21+/m1/s1 |
| InChIKey | JZIQLLUSQFXKKR-RTWAWAEBSA-N |
| XLogP | 6.42 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.09 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|