C29H32ClN7O4 — CID 118034015
tert-butyl N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]-N-[(4-nitrophenyl)methyl]carbamate (PubChem CID 118034015) has the molecular formula C29H32ClN7O4 and a molecular weight of 578.07 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]-N-[(4-nitrophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]-N-[(4-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 118034015 |
| Molecular Formula | C29H32ClN7O4 |
| Molecular Weight | 578.07 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]-N-[(4-nitrophenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc([N+](=O)[O-])cc1)[C@H]1CCC[C@@H](Nc2ncc(Cl)c(-c3n[nH]c4ccccc34)n2)C1 |
| InChI | InChI=1S/C29H32ClN7O4/c1-29(2,3)41-28(38)36(17-18-11-13-20(14-12-18)37(39)40)21-8-6-7-19(15-21)32-27-31-16-23(30)26(33-27)25-22-9-4-5-10-24(22)34-35-25/h4-5,9-14,16,19,21H,6-8,15,17H2,1-3H3,(H,34,35)(H,31,32,33)/t19-,21+/m1/s1 |
| InChIKey | MHCCXMFXCRGQHW-CTNGQTDRSA-N |
| XLogP | 6.74 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.07 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|