C24H24ClN7O2 — CID 118034057
cis-(1R,3S)-1-N-[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]-3-N-[(4-nitrophenyl)methyl]cyclohexane-1,3-diamine (PubChem CID 118034057) has the molecular formula C24H24ClN7O2 and a molecular weight of 477.96 g/mol. Its IUPAC name is cis-(1R,3S)-1-N-[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]-3-N-[(4-nitrophenyl)methyl]cyclohexane-1,3-diamine.
| Compound Name | cis-(1R,3S)-1-N-[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]-3-N-[(4-nitrophenyl)methyl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 118034057 |
| Molecular Formula | C24H24ClN7O2 |
| Molecular Weight | 477.96 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | cis-(1R,3S)-1-N-[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]-3-N-[(4-nitrophenyl)methyl]cyclohexane-1,3-diamine |
| SMILES | O=[N+]([O-])c1ccc(CN[C@H]2CCC[C@@H](Nc3ncc(Cl)c(-c4n[nH]c5ccccc45)n3)C2)cc1 |
| InChI | InChI=1S/C24H24ClN7O2/c25-20-14-27-24(29-23(20)22-19-6-1-2-7-21(19)30-31-22)28-17-5-3-4-16(12-17)26-13-15-8-10-18(11-9-15)32(33)34/h1-2,6-11,14,16-17,26H,3-5,12-13H2,(H,30,31)(H,27,28,29)/t16-,17+/m0/s1 |
| InChIKey | VIDADYHSGRXEJM-DLBZAZTESA-N |
| XLogP | 5.09 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.96 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|