C32H40N4O6 — CID 118034341
methyl (18R,20R,25S,28S)-25-tert-butyl-7-methoxy-23,26-dioxo-2-oxa-4,11,24,27-tetrazapentacyclo[25.2.1.03,12.05,10.018,20]triaconta-3,5(10),6,8,11-pentaen-13-yne-28-carboxylate (PubChem CID 118034341) has the molecular formula C32H40N4O6 and a molecular weight of 576.69 g/mol. Its IUPAC name is methyl (18R,20R,25S,28S)-25-tert-butyl-7-methoxy-23,26-dioxo-2-oxa-4,11,24,27-tetrazapentacyclo[25.2.1.03,12.05,10.018,20]triaconta-3,5(10),6,8,11-pentaen-13-yne-28-carboxylate.
| Compound Name | methyl (18R,20R,25S,28S)-25-tert-butyl-7-methoxy-23,26-dioxo-2-oxa-4,11,24,27-tetrazapentacyclo[25.2.1.03,12.05,10.018,20]triaconta-3,5(10),6,8,11-pentaen-13-yne-28-carboxylate |
|---|---|
| PubChem CID | 118034341 |
| Molecular Formula | C32H40N4O6 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | methyl (18R,20R,25S,28S)-25-tert-butyl-7-methoxy-23,26-dioxo-2-oxa-4,11,24,27-tetrazapentacyclo[25.2.1.03,12.05,10.018,20]triaconta-3,5(10),6,8,11-pentaen-13-yne-28-carboxylate |
| SMILES | COC(=O)[C@@H]1CC2CN1C(=O)[C@H](C(C)(C)C)NC(=O)CC[C@@H]1C[C@H]1CCCC#Cc1nc3ccc(OC)cc3nc1O2 |
| InChI | InChI=1S/C32H40N4O6/c1-32(2,3)28-30(38)36-18-22(17-26(36)31(39)41-5)42-29-24(33-23-13-12-21(40-4)16-25(23)34-29)10-8-6-7-9-19-15-20(19)11-14-27(37)35-28/h12-13,16,19-20,22,26,28H,6-7,9,11,14-15,17-18H2,1-5H3,(H,35,37)/t19-,20-,22?,26+,28-/m1/s1 |
| InChIKey | MZSVNRIHWKCIRT-YVJACFDBSA-N |
| XLogP | 3.64 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|