C19H19N5 — CID 118034348
3-cyclopentyl-3-(4,10,12,14-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaen-4-yl)propanenitrile (PubChem CID 118034348) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is 3-cyclopentyl-3-(4,10,12,14-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaen-4-yl)propanenitrile.
| Compound Name | 3-cyclopentyl-3-(4,10,12,14-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaen-4-yl)propanenitrile |
|---|---|
| PubChem CID | 118034348 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-cyclopentyl-3-(4,10,12,14-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaen-4-yl)propanenitrile |
| SMILES | N#CCC(C1CCCC1)n1cc2c(c1)-c1ncnc3[nH]cc(c13)C2 |
| InChI | InChI=1S/C19H19N5/c20-6-5-16(12-3-1-2-4-12)24-9-14-7-13-8-21-19-17(13)18(15(14)10-24)22-11-23-19/h8-12,16H,1-5,7H2,(H,21,22,23) |
| InChIKey | JKHINRDDXSEFNT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |