About 3-bromo-2-N,6-dimethylpyridine-2,5-diamine
3-bromo-2-N,6-dimethylpyridine-2,5-diamine (PubChem CID 118034753) has the molecular formula C7H10BrN3
and a molecular weight of 216.08 g/mol. Its IUPAC name is 3-bromo-2-N,6-dimethylpyridine-2,5-diamine.
Molecular Properties
| Compound Name | 3-bromo-2-N,6-dimethylpyridine-2,5-diamine |
| PubChem CID | 118034753 |
| Molecular Formula | C7H10BrN3 |
| Molecular Weight | 216.08 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 3-bromo-2-N,6-dimethylpyridine-2,5-diamine |
| SMILES | CNc1nc(C)c(N)cc1Br |
| InChI | InChI=1S/C7H10BrN3/c1-4-6(9)3-5(8)7(10-2)11-4/h3H,9H2,1-2H3,(H,10,11) |
| InChIKey | UUBUIAIOOCKSBM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.08 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-2-N,6-dimethylpyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-N,6-dimethylpyridine-2,5-diamine?
The IUPAC name of 3-bromo-2-N,6-dimethylpyridine-2,5-diamine (CID 118034753) is 3-bromo-2-N,6-dimethylpyridine-2,5-diamine.
What is the SMILES notation for 3-bromo-2-N,6-dimethylpyridine-2,5-diamine?
The canonical SMILES for 3-bromo-2-N,6-dimethylpyridine-2,5-diamine is CNc1nc(C)c(N)cc1Br.
What is the InChIKey of 3-bromo-2-N,6-dimethylpyridine-2,5-diamine?
The InChIKey is UUBUIAIOOCKSBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrN3/c1-4-6(9)3-5(8)7(10-2)11-4/h3H,9H2,1-2H3,(H,10,11).
What are the key properties of 3-bromo-2-N,6-dimethylpyridine-2,5-diamine?
3-bromo-2-N,6-dimethylpyridine-2,5-diamine has a molecular weight of 216.08 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-N,6-dimethylpyridine-2,5-diamine is sourced from PubChem (CID 118034753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).