C20H20ClN3O4S — CID 118034926
N-[4-[(6-chloro-1,3-benzothiazol-2-yl)amino]oxolan-3-yl]-2,6-dimethoxybenzamide (PubChem CID 118034926) has the molecular formula C20H20ClN3O4S and a molecular weight of 433.92 g/mol. Its IUPAC name is N-[4-[(6-chloro-1,3-benzothiazol-2-yl)amino]oxolan-3-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[4-[(6-chloro-1,3-benzothiazol-2-yl)amino]oxolan-3-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 118034926 |
| Molecular Formula | C20H20ClN3O4S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-[4-[(6-chloro-1,3-benzothiazol-2-yl)amino]oxolan-3-yl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC1COCC1Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C20H20ClN3O4S/c1-26-15-4-3-5-16(27-2)18(15)19(25)22-13-9-28-10-14(13)24-20-23-12-7-6-11(21)8-17(12)29-20/h3-8,13-14H,9-10H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | VWEKNQAXJFBOQH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |