About 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol
6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol (PubChem CID 118035113) has the molecular formula C9H8BrF3N2O
and a molecular weight of 297.07 g/mol. Its IUPAC name is 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol.
Molecular Properties
| Compound Name | 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol |
| PubChem CID | 118035113 |
| Molecular Formula | C9H8BrF3N2O |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol |
| SMILES | CC1=C(Br)C=CC2=NC(O)(C(F)(F)F)CN21 |
| InChI | InChI=1S/C9H8BrF3N2O/c1-5-6(10)2-3-7-14-8(16,4-15(5)7)9(11,12)13/h2-3,16H,4H2,1H3 |
| InChIKey | ISHZBIUUEKSGDM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol?
The IUPAC name of 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol (CID 118035113) is 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol.
What is the SMILES notation for 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol?
The canonical SMILES for 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol is CC1=C(Br)C=CC2=NC(O)(C(F)(F)F)CN21.
What is the InChIKey of 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol?
The InChIKey is ISHZBIUUEKSGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrF3N2O/c1-5-6(10)2-3-7-14-8(16,4-15(5)7)9(11,12)13/h2-3,16H,4H2,1H3.
What are the key properties of 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol?
6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol has a molecular weight of 297.07 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol is sourced from PubChem (CID 118035113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).