C10H8BrF5N2O — CID 118035221
6-bromo-5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol (PubChem CID 118035221) has the molecular formula C10H8BrF5N2O and a molecular weight of 347.08 g/mol. Its IUPAC name is 6-bromo-5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol.
| Compound Name | 6-bromo-5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol |
|---|---|
| PubChem CID | 118035221 |
| Molecular Formula | C10H8BrF5N2O |
| Molecular Weight | 347.08 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 6-bromo-5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol |
| SMILES | CC1=C(Br)C=CC2=NC(O)(C(F)(F)C(F)(F)F)CN21 |
| InChI | InChI=1S/C10H8BrF5N2O/c1-5-6(11)2-3-7-17-8(19,4-18(5)7)9(12,13)10(14,15)16/h2-3,19H,4H2,1H3 |
| InChIKey | HKNOZFQQMDJGLE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.08 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|