C11H16N2O2 — CID 118035515
[(3aS,6aR)-5-cyano-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl] carbamate (PubChem CID 118035515) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is [(3aS,6aR)-5-cyano-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl] carbamate.
| Compound Name | [(3aS,6aR)-5-cyano-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl] carbamate |
|---|---|
| PubChem CID | 118035515 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | [(3aS,6aR)-5-cyano-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl] carbamate |
| SMILES | CC1(OC(N)=O)C[C@H]2CC(C#N)C[C@H]2C1 |
| InChI | InChI=1S/C11H16N2O2/c1-11(15-10(13)14)4-8-2-7(6-12)3-9(8)5-11/h7-9H,2-5H2,1H3,(H2,13,14)/t7?,8-,9+,11? |
| InChIKey | QCNPZWZSNWTTEY-SNWHPCCYSA-N |
| XLogP | 1.80 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |