C23H29N5O4S — CID 118035549
4-[[3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide (PubChem CID 118035549) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is 4-[[3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 118035549 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 4-[[3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)Nc1cccc(C(=O)NC2C3CC4CC2CC(C(N)=O)(C4)C3)c1 |
| InChI | InChI=1S/C23H29N5O4S/c1-12-20(13(2)27-26-12)33(31,32)28-18-5-3-4-15(8-18)21(29)25-19-16-6-14-7-17(19)11-23(9-14,10-16)22(24)30/h3-5,8,14,16-17,19,28H,6-7,9-11H2,1-2H3,(H2,24,30)(H,25,29)(H,26,27) |
| InChIKey | YGOLDIIQUQMTLM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |