C23H19Cl3F3N3O4S — CID 118035802
[3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-[(3R)-2-oxopyrrolidin-3-yl]carbamate (PubChem CID 118035802) has the molecular formula C23H19Cl3F3N3O4S and a molecular weight of 596.84 g/mol. Its IUPAC name is [3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-[(3R)-2-oxopyrrolidin-3-yl]carbamate.
| Compound Name | [3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-[(3R)-2-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 118035802 |
| Molecular Formula | C23H19Cl3F3N3O4S |
| Molecular Weight | 596.84 g/mol |
| Exact Mass | 595.01 |
| IUPAC Name | [3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-[(3R)-2-oxopyrrolidin-3-yl]carbamate |
| SMILES | O=C(N[C@@H]1CCNC1=O)Oc1sc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)c2c1CCCC2 |
| InChI | InChI=1S/C23H19Cl3F3N3O4S/c24-13-7-10(8-14(25)17(13)26)22(23(27,28)29)9-16(32-36-22)18-11-3-1-2-4-12(11)20(37-18)35-21(34)31-15-5-6-30-19(15)33/h7-8,15H,1-6,9H2,(H,30,33)(H,31,34)/t15-,22?/m1/s1 |
| InChIKey | CUARYJQTHRZJHG-JGHKVMFLSA-N |
| XLogP | 6.15 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.84 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|