C24H32N6O5 — CID 118036182
N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-(dimethoxymethyl)-6-[(dimethylamino)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036182) has the molecular formula C24H32N6O5 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-(dimethoxymethyl)-6-[(dimethylamino)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-(dimethoxymethyl)-6-[(dimethylamino)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036182 |
| Molecular Formula | C24H32N6O5 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-(dimethoxymethyl)-6-[(dimethylamino)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COCCOc1cc(NC(=O)N2CCCc3cc(CN(C)C)c(C(OC)OC)nc32)ncc1C#N |
| InChI | InChI=1S/C24H32N6O5/c1-29(2)15-17-11-16-7-6-8-30(22(16)28-21(17)23(33-4)34-5)24(31)27-20-12-19(35-10-9-32-3)18(13-25)14-26-20/h11-12,14,23H,6-10,15H2,1-5H3,(H,26,27,31) |
| InChIKey | BHSWSMZBWXWPNT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|