C23H26N6O5 — CID 118036192
6-[[acetyl(methyl)amino]methyl]-N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036192) has the molecular formula C23H26N6O5 and a molecular weight of 466.50 g/mol. Its IUPAC name is 6-[[acetyl(methyl)amino]methyl]-N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | 6-[[acetyl(methyl)amino]methyl]-N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036192 |
| Molecular Formula | C23H26N6O5 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 6-[[acetyl(methyl)amino]methyl]-N-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COCCOc1cc(NC(=O)N2CCCc3cc(CN(C)C(C)=O)c(C=O)nc32)ncc1C#N |
| InChI | InChI=1S/C23H26N6O5/c1-15(31)28(2)13-17-9-16-5-4-6-29(22(16)26-19(17)14-30)23(32)27-21-10-20(34-8-7-33-3)18(11-24)12-25-21/h9-10,12,14H,4-8,13H2,1-3H3,(H,25,27,32) |
| InChIKey | LKLLFMPSJSCSDN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|